C14H19ClO — CID 54514707
(1-chloro-3,3,4-trimethylpent-1-en-2-yl)oxybenzene (PubChem CID 54514707) has the molecular formula C14H19ClO and a molecular weight of 238.76 g/mol. Its IUPAC name is (1-chloro-3,3,4-trimethylpent-1-en-2-yl)oxybenzene.
| Compound Name | (1-chloro-3,3,4-trimethylpent-1-en-2-yl)oxybenzene |
|---|---|
| PubChem CID | 54514707 |
| Molecular Formula | C14H19ClO |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (1-chloro-3,3,4-trimethylpent-1-en-2-yl)oxybenzene |
| SMILES | CC(C)C(C)(C)C(=CCl)Oc1ccccc1 |
| InChI | InChI=1S/C14H19ClO/c1-11(2)14(3,4)13(10-15)16-12-8-6-5-7-9-12/h5-11H,1-4H3 |
| InChIKey | YLPGGOVAJRZHGV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|