About 5-[7-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]heptyl]-3-methyl-1,2-oxazole
5-[7-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]heptyl]-3-methyl-1,2-oxazole (PubChem CID 54515023) has the molecular formula C18H22ClN3OS
and a molecular weight of 363.91 g/mol. Its IUPAC name is 5-[7-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]heptyl]-3-methyl-1,2-oxazole.
Molecular Properties
| Compound Name | 5-[7-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]heptyl]-3-methyl-1,2-oxazole |
| PubChem CID | 54515023 |
| Molecular Formula | C18H22ClN3OS |
| Molecular Weight | 363.91 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 5-[7-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]heptyl]-3-methyl-1,2-oxazole |
| SMILES | Cc1cc(CCCCCCCSc2nc3ccc(Cl)cc3[nH]2)on1 |
| InChI | InChI=1S/C18H22ClN3OS/c1-13-11-15(23-22-13)7-5-3-2-4-6-10-24-18-20-16-9-8-14(19)12-17(16)21-18/h8-9,11-12H,2-7,10H2,1H3,(H,20,21) |
| InChIKey | YLVBZOMGSXVDDQ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.91 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[7-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]heptyl]-3-methyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[7-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]heptyl]-3-methyl-1,2-oxazole?
The IUPAC name of 5-[7-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]heptyl]-3-methyl-1,2-oxazole (CID 54515023) is 5-[7-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]heptyl]-3-methyl-1,2-oxazole.
What is the SMILES notation for 5-[7-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]heptyl]-3-methyl-1,2-oxazole?
The canonical SMILES for 5-[7-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]heptyl]-3-methyl-1,2-oxazole is Cc1cc(CCCCCCCSc2nc3ccc(Cl)cc3[nH]2)on1.
What is the InChIKey of 5-[7-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]heptyl]-3-methyl-1,2-oxazole?
The InChIKey is YLVBZOMGSXVDDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22ClN3OS/c1-13-11-15(23-22-13)7-5-3-2-4-6-10-24-18-20-16-9-8-14(19)12-17(16)21-18/h8-9,11-12H,2-7,10H2,1H3,(H,20,21).
What are the key properties of 5-[7-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]heptyl]-3-methyl-1,2-oxazole?
5-[7-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]heptyl]-3-methyl-1,2-oxazole has a molecular weight of 363.91 g/mol, XLogP of 5.80, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[7-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]heptyl]-3-methyl-1,2-oxazole is sourced from PubChem (CID 54515023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).