About [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1,3-dimethylpyrazol-5-yl] benzoate
[4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1,3-dimethylpyrazol-5-yl] benzoate (PubChem CID 54515593) has the molecular formula C22H21ClN2O5S
and a molecular weight of 460.94 g/mol. Its IUPAC name is [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1,3-dimethylpyrazol-5-yl] benzoate.
Molecular Properties
| Compound Name | [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1,3-dimethylpyrazol-5-yl] benzoate |
| PubChem CID | 54515593 |
| Molecular Formula | C22H21ClN2O5S |
| Molecular Weight | 460.94 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1,3-dimethylpyrazol-5-yl] benzoate |
| SMILES | Cc1cc(C(=O)c2c(C)nn(C)c2OC(=O)c2ccccc2)c(Cl)c(C)c1S(C)(=O)=O |
| InChI | InChI=1S/C22H21ClN2O5S/c1-12-11-16(18(23)13(2)20(12)31(5,28)29)19(26)17-14(3)24-25(4)21(17)30-22(27)15-9-7-6-8-10-15/h6-11H,1-5H3 |
| InChIKey | YMEZRHAUFIYBBB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.94 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1,3-dimethylpyrazol-5-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1,3-dimethylpyrazol-5-yl] benzoate?
The IUPAC name of [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1,3-dimethylpyrazol-5-yl] benzoate (CID 54515593) is [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1,3-dimethylpyrazol-5-yl] benzoate.
What is the SMILES notation for [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1,3-dimethylpyrazol-5-yl] benzoate?
The canonical SMILES for [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1,3-dimethylpyrazol-5-yl] benzoate is Cc1cc(C(=O)c2c(C)nn(C)c2OC(=O)c2ccccc2)c(Cl)c(C)c1S(C)(=O)=O.
What is the InChIKey of [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1,3-dimethylpyrazol-5-yl] benzoate?
The InChIKey is YMEZRHAUFIYBBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21ClN2O5S/c1-12-11-16(18(23)13(2)20(12)31(5,28)29)19(26)17-14(3)24-25(4)21(17)30-22(27)15-9-7-6-8-10-15/h6-11H,1-5H3.
What are the key properties of [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1,3-dimethylpyrazol-5-yl] benzoate?
[4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1,3-dimethylpyrazol-5-yl] benzoate has a molecular weight of 460.94 g/mol, XLogP of 3.85, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1,3-dimethylpyrazol-5-yl] benzoate is sourced from PubChem (CID 54515593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).