C6H4F3NO4 — CID 54515596
(2,5-dihydroxypyrrol-1-yl) 2,2,2-trifluoroacetate (PubChem CID 54515596) has the molecular formula C6H4F3NO4 and a molecular weight of 211.09 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2,2,2-trifluoroacetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 54515596 |
| Molecular Formula | C6H4F3NO4 |
| Molecular Weight | 211.09 g/mol |
| Exact Mass | 211.01 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2,2,2-trifluoroacetate |
| SMILES | O=C(On1c(O)ccc1O)C(F)(F)F |
| InChI | InChI=1S/C6H4F3NO4/c7-6(8,9)5(13)14-10-3(11)1-2-4(10)12/h1-2,11-12H |
| InChIKey | YMFAOZNZGFXKJO-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.09 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |