About 3-ethenyl-4-ethyl-1H-pyrrole-2,5-diol
3-ethenyl-4-ethyl-1H-pyrrole-2,5-diol (PubChem CID 54515667) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is 3-ethenyl-4-ethyl-1H-pyrrole-2,5-diol.
Molecular Properties
| Compound Name | 3-ethenyl-4-ethyl-1H-pyrrole-2,5-diol |
| PubChem CID | 54515667 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 3-ethenyl-4-ethyl-1H-pyrrole-2,5-diol |
| SMILES | C=Cc1c(O)[nH]c(O)c1CC |
| InChI | InChI=1S/C8H11NO2/c1-3-5-6(4-2)8(11)9-7(5)10/h3,9-11H,1,4H2,2H3 |
| InChIKey | YMFXQQNVNXIDJE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethenyl-4-ethyl-1H-pyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-4-ethyl-1H-pyrrole-2,5-diol?
The IUPAC name of 3-ethenyl-4-ethyl-1H-pyrrole-2,5-diol (CID 54515667) is 3-ethenyl-4-ethyl-1H-pyrrole-2,5-diol.
What is the SMILES notation for 3-ethenyl-4-ethyl-1H-pyrrole-2,5-diol?
The canonical SMILES for 3-ethenyl-4-ethyl-1H-pyrrole-2,5-diol is C=Cc1c(O)[nH]c(O)c1CC.
What is the InChIKey of 3-ethenyl-4-ethyl-1H-pyrrole-2,5-diol?
The InChIKey is YMFXQQNVNXIDJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-3-5-6(4-2)8(11)9-7(5)10/h3,9-11H,1,4H2,2H3.
What are the key properties of 3-ethenyl-4-ethyl-1H-pyrrole-2,5-diol?
3-ethenyl-4-ethyl-1H-pyrrole-2,5-diol has a molecular weight of 153.18 g/mol, XLogP of 1.63, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-4-ethyl-1H-pyrrole-2,5-diol is sourced from PubChem (CID 54515667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).