C25H46N2O2 — CID 54515682
3-dodecan-3-yl-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrole-2,5-diol (PubChem CID 54515682) has the molecular formula C25H46N2O2 and a molecular weight of 406.66 g/mol. Its IUPAC name is 3-dodecan-3-yl-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrole-2,5-diol.
| Compound Name | 3-dodecan-3-yl-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 54515682 |
| Molecular Formula | C25H46N2O2 |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 406.36 |
| IUPAC Name | 3-dodecan-3-yl-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrole-2,5-diol |
| SMILES | CCCCCCCCCC(CC)c1cc(O)n(C2CC(C)(C)NC(C)(C)C2)c1O |
| InChI | InChI=1S/C25H46N2O2/c1-7-9-10-11-12-13-14-15-19(8-2)21-16-22(28)27(23(21)29)20-17-24(3,4)26-25(5,6)18-20/h16,19-20,26,28-29H,7-15,17-18H2,1-6H3 |
| InChIKey | YMGFXIWPHGJYNQ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|