About 1-methoxy-3,7-dimethylocta-1,3,6-triene
1-methoxy-3,7-dimethylocta-1,3,6-triene (PubChem CID 54516095) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is 1-methoxy-3,7-dimethylocta-1,3,6-triene.
Molecular Properties
| Compound Name | 1-methoxy-3,7-dimethylocta-1,3,6-triene |
| PubChem CID | 54516095 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 1-methoxy-3,7-dimethylocta-1,3,6-triene |
| SMILES | COC=CC(C)=CCC=C(C)C |
| InChI | InChI=1S/C11H18O/c1-10(2)6-5-7-11(3)8-9-12-4/h6-9H,5H2,1-4H3 |
| InChIKey | YMNFVXLZEWHHIF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-3,7-dimethylocta-1,3,6-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-3,7-dimethylocta-1,3,6-triene?
The IUPAC name of 1-methoxy-3,7-dimethylocta-1,3,6-triene (CID 54516095) is 1-methoxy-3,7-dimethylocta-1,3,6-triene.
What is the SMILES notation for 1-methoxy-3,7-dimethylocta-1,3,6-triene?
The canonical SMILES for 1-methoxy-3,7-dimethylocta-1,3,6-triene is COC=CC(C)=CCC=C(C)C.
What is the InChIKey of 1-methoxy-3,7-dimethylocta-1,3,6-triene?
The InChIKey is YMNFVXLZEWHHIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O/c1-10(2)6-5-7-11(3)8-9-12-4/h6-9H,5H2,1-4H3.
What are the key properties of 1-methoxy-3,7-dimethylocta-1,3,6-triene?
1-methoxy-3,7-dimethylocta-1,3,6-triene has a molecular weight of 166.26 g/mol, XLogP of 3.45, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-3,7-dimethylocta-1,3,6-triene is sourced from PubChem (CID 54516095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).