C16H16F3N5O — CID 54516110
6-[[3-(trifluoromethyl)phenyl]methoxyimino]-7,8-dihydro-5H-quinazoline-2,4-diamine (PubChem CID 54516110) has the molecular formula C16H16F3N5O and a molecular weight of 351.33 g/mol. Its IUPAC name is 6-[[3-(trifluoromethyl)phenyl]methoxyimino]-7,8-dihydro-5H-quinazoline-2,4-diamine.
| Compound Name | 6-[[3-(trifluoromethyl)phenyl]methoxyimino]-7,8-dihydro-5H-quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 54516110 |
| Molecular Formula | C16H16F3N5O |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 6-[[3-(trifluoromethyl)phenyl]methoxyimino]-7,8-dihydro-5H-quinazoline-2,4-diamine |
| SMILES | Nc1nc(N)c2c(n1)CCC(=NOCc1cccc(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C16H16F3N5O/c17-16(18,19)10-3-1-2-9(6-10)8-25-24-11-4-5-13-12(7-11)14(20)23-15(21)22-13/h1-3,6H,4-5,7-8H2,(H4,20,21,22,23) |
| InChIKey | YMNPOMQRUZOEPV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|