C17H24N2S — CID 54516230
1-[2-(4-methylsulfanylphenyl)prop-2-enyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrimidine (PubChem CID 54516230) has the molecular formula C17H24N2S and a molecular weight of 288.46 g/mol. Its IUPAC name is 1-[2-(4-methylsulfanylphenyl)prop-2-enyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrimidine.
| Compound Name | 1-[2-(4-methylsulfanylphenyl)prop-2-enyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 54516230 |
| Molecular Formula | C17H24N2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 1-[2-(4-methylsulfanylphenyl)prop-2-enyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrimidine |
| SMILES | C=C(CN1CCCN2CCCC21)c1ccc(SC)cc1 |
| InChI | InChI=1S/C17H24N2S/c1-14(15-6-8-16(20-2)9-7-15)13-19-12-4-11-18-10-3-5-17(18)19/h6-9,17H,1,3-5,10-13H2,2H3 |
| InChIKey | YMPNLODHOZJGPY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |