About 5-amino-1,1-bis(dimethoxyphosphoryl)pentan-1-ol
5-amino-1,1-bis(dimethoxyphosphoryl)pentan-1-ol (PubChem CID 54516479) has the molecular formula C9H23NO7P2
and a molecular weight of 319.23 g/mol. Its IUPAC name is 5-amino-1,1-bis(dimethoxyphosphoryl)pentan-1-ol.
Molecular Properties
| Compound Name | 5-amino-1,1-bis(dimethoxyphosphoryl)pentan-1-ol |
| PubChem CID | 54516479 |
| Molecular Formula | C9H23NO7P2 |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 5-amino-1,1-bis(dimethoxyphosphoryl)pentan-1-ol |
| SMILES | COP(=O)(OC)C(O)(CCCCN)P(=O)(OC)OC |
| InChI | InChI=1S/C9H23NO7P2/c1-14-18(12,15-2)9(11,7-5-6-8-10)19(13,16-3)17-4/h11H,5-8,10H2,1-4H3 |
| InChIKey | YMTVHRBDVDOTRS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-1,1-bis(dimethoxyphosphoryl)pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1,1-bis(dimethoxyphosphoryl)pentan-1-ol?
The IUPAC name of 5-amino-1,1-bis(dimethoxyphosphoryl)pentan-1-ol (CID 54516479) is 5-amino-1,1-bis(dimethoxyphosphoryl)pentan-1-ol.
What is the SMILES notation for 5-amino-1,1-bis(dimethoxyphosphoryl)pentan-1-ol?
The canonical SMILES for 5-amino-1,1-bis(dimethoxyphosphoryl)pentan-1-ol is COP(=O)(OC)C(O)(CCCCN)P(=O)(OC)OC.
What is the InChIKey of 5-amino-1,1-bis(dimethoxyphosphoryl)pentan-1-ol?
The InChIKey is YMTVHRBDVDOTRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H23NO7P2/c1-14-18(12,15-2)9(11,7-5-6-8-10)19(13,16-3)17-4/h11H,5-8,10H2,1-4H3.
What are the key properties of 5-amino-1,1-bis(dimethoxyphosphoryl)pentan-1-ol?
5-amino-1,1-bis(dimethoxyphosphoryl)pentan-1-ol has a molecular weight of 319.23 g/mol, XLogP of 1.73, 10 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1,1-bis(dimethoxyphosphoryl)pentan-1-ol is sourced from PubChem (CID 54516479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).