C19H26O3 — CID 54516669
ethane;2-hydroxy-6-[(3-methylphenyl)methyl]benzoic acid (PubChem CID 54516669) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is ethane;2-hydroxy-6-[(3-methylphenyl)methyl]benzoic acid.
| Compound Name | ethane;2-hydroxy-6-[(3-methylphenyl)methyl]benzoic acid |
|---|---|
| PubChem CID | 54516669 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | ethane;2-hydroxy-6-[(3-methylphenyl)methyl]benzoic acid |
| SMILES | CC.CC.Cc1cccc(Cc2cccc(O)c2C(=O)O)c1 |
| InChI | InChI=1S/C15H14O3.2C2H6/c1-10-4-2-5-11(8-10)9-12-6-3-7-13(16)14(12)15(17)18;2*1-2/h2-8,16H,9H2,1H3,(H,17,18);2*1-2H3 |
| InChIKey | YMWYGZKXIWMWIA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |