About platinum;bis(tritert-butylphosphane)
platinum;bis(tritert-butylphosphane) (PubChem CID 545169) has the molecular formula C24H54P2Pt
and a molecular weight of 599.72 g/mol. Its IUPAC name is platinum;bis(tritert-butylphosphane).
Molecular Properties
| Compound Name | platinum;bis(tritert-butylphosphane) |
| PubChem CID | 545169 |
| Molecular Formula | C24H54P2Pt |
| Molecular Weight | 599.72 g/mol |
| Exact Mass | 599.33 |
| IUPAC Name | platinum;bis(tritert-butylphosphane) |
| SMILES | CC(C)(C)P(C(C)(C)C)C(C)(C)C.CC(C)(C)P(C(C)(C)C)C(C)(C)C.[Pt] |
| InChI | InChI=1S/2C12H27P.Pt/c2*1-10(2,3)13(11(4,5)6)12(7,8)9;/h2*1-9H3; |
| InChIKey | RJQWVEJVXWLMRE-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 599.72 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze platinum;bis(tritert-butylphosphane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of platinum;bis(tritert-butylphosphane)?
The IUPAC name of platinum;bis(tritert-butylphosphane) (CID 545169) is platinum;bis(tritert-butylphosphane).
What is the SMILES notation for platinum;bis(tritert-butylphosphane)?
The canonical SMILES for platinum;bis(tritert-butylphosphane) is CC(C)(C)P(C(C)(C)C)C(C)(C)C.CC(C)(C)P(C(C)(C)C)C(C)(C)C.[Pt].
What is the InChIKey of platinum;bis(tritert-butylphosphane)?
The InChIKey is RJQWVEJVXWLMRE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H27P.Pt/c2*1-10(2,3)13(11(4,5)6)12(7,8)9;/h2*1-9H3;.
What are the key properties of platinum;bis(tritert-butylphosphane)?
platinum;bis(tritert-butylphosphane) has a molecular weight of 599.72 g/mol, XLogP of 9.73, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for platinum;bis(tritert-butylphosphane) is sourced from PubChem (CID 545169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).