About 6-methyl-3H-imidazo[1,2-a]pyridin-2-one
6-methyl-3H-imidazo[1,2-a]pyridin-2-one (PubChem CID 54517033) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is 6-methyl-3H-imidazo[1,2-a]pyridin-2-one.
Molecular Properties
| Compound Name | 6-methyl-3H-imidazo[1,2-a]pyridin-2-one |
| PubChem CID | 54517033 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 6-methyl-3H-imidazo[1,2-a]pyridin-2-one |
| SMILES | CC1=CN2CC(=O)N=C2C=C1 |
| InChI | InChI=1S/C8H8N2O/c1-6-2-3-7-9-8(11)5-10(7)4-6/h2-4H,5H2,1H3 |
| InChIKey | YNCRMGGYATXXLO-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-3H-imidazo[1,2-a]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3H-imidazo[1,2-a]pyridin-2-one?
The IUPAC name of 6-methyl-3H-imidazo[1,2-a]pyridin-2-one (CID 54517033) is 6-methyl-3H-imidazo[1,2-a]pyridin-2-one.
What is the SMILES notation for 6-methyl-3H-imidazo[1,2-a]pyridin-2-one?
The canonical SMILES for 6-methyl-3H-imidazo[1,2-a]pyridin-2-one is CC1=CN2CC(=O)N=C2C=C1.
What is the InChIKey of 6-methyl-3H-imidazo[1,2-a]pyridin-2-one?
The InChIKey is YNCRMGGYATXXLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O/c1-6-2-3-7-9-8(11)5-10(7)4-6/h2-4H,5H2,1H3.
What are the key properties of 6-methyl-3H-imidazo[1,2-a]pyridin-2-one?
6-methyl-3H-imidazo[1,2-a]pyridin-2-one has a molecular weight of 148.16 g/mol, XLogP of 0.70, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3H-imidazo[1,2-a]pyridin-2-one is sourced from PubChem (CID 54517033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).