C13H18FNO — CID 54517292
(2R,3R,5S)-2-(2-fluorophenyl)-3,4,5-trimethylmorpholine (PubChem CID 54517292) has the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. Its IUPAC name is (2R,3R,5S)-2-(2-fluorophenyl)-3,4,5-trimethylmorpholine.
| Compound Name | (2R,3R,5S)-2-(2-fluorophenyl)-3,4,5-trimethylmorpholine |
|---|---|
| PubChem CID | 54517292 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (2R,3R,5S)-2-(2-fluorophenyl)-3,4,5-trimethylmorpholine |
| SMILES | C[C@@H]1[C@@H](c2ccccc2F)OC[C@H](C)N1C |
| InChI | InChI=1S/C13H18FNO/c1-9-8-16-13(10(2)15(9)3)11-6-4-5-7-12(11)14/h4-7,9-10,13H,8H2,1-3H3/t9-,10+,13-/m0/s1 |
| InChIKey | YNHBBNAVISRTHM-CWSCBRNRSA-N |
| XLogP | 2.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |