C12H18N2OS2 — CID 54517654
4-(4-aminobutyl)-7-methyl-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one (PubChem CID 54517654) has the molecular formula C12H18N2OS2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 4-(4-aminobutyl)-7-methyl-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one.
| Compound Name | 4-(4-aminobutyl)-7-methyl-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 54517654 |
| Molecular Formula | C12H18N2OS2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 4-(4-aminobutyl)-7-methyl-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one |
| SMILES | Cc1cc2c(s1)SCCN(CCCCN)C2=O |
| InChI | InChI=1S/C12H18N2OS2/c1-9-8-10-11(15)14(5-3-2-4-13)6-7-16-12(10)17-9/h8H,2-7,13H2,1H3 |
| InChIKey | YNNLKILJLWUUAG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|