C25H30ClN3OS — CID 54517865
1-(4-chlorophenyl)-8-[5-[(6-methyl-3-pyridinyl)methyl]pyrimidin-2-yl]sulfanyloctan-1-ol (PubChem CID 54517865) has the molecular formula C25H30ClN3OS and a molecular weight of 456.06 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-8-[5-[(6-methyl-3-pyridinyl)methyl]pyrimidin-2-yl]sulfanyloctan-1-ol.
| Compound Name | 1-(4-chlorophenyl)-8-[5-[(6-methyl-3-pyridinyl)methyl]pyrimidin-2-yl]sulfanyloctan-1-ol |
|---|---|
| PubChem CID | 54517865 |
| Molecular Formula | C25H30ClN3OS |
| Molecular Weight | 456.06 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 1-(4-chlorophenyl)-8-[5-[(6-methyl-3-pyridinyl)methyl]pyrimidin-2-yl]sulfanyloctan-1-ol |
| SMILES | Cc1ccc(Cc2cnc(SCCCCCCCC(O)c3ccc(Cl)cc3)nc2)cn1 |
| InChI | InChI=1S/C25H30ClN3OS/c1-19-8-9-20(16-27-19)15-21-17-28-25(29-18-21)31-14-6-4-2-3-5-7-24(30)22-10-12-23(26)13-11-22/h8-13,16-18,24,30H,2-7,14-15H2,1H3 |
| InChIKey | YNQWLSNDNHXLDD-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.06 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|