About 2-piperidin-4-yl-1,3-oxazole
2-piperidin-4-yl-1,3-oxazole (PubChem CID 54518272) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 2-piperidin-4-yl-1,3-oxazole.
Molecular Properties
| Compound Name | 2-piperidin-4-yl-1,3-oxazole |
| PubChem CID | 54518272 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 2-piperidin-4-yl-1,3-oxazole |
| SMILES | c1coc(C2CCNCC2)n1 |
| InChI | InChI=1S/C8H12N2O/c1-3-9-4-2-7(1)8-10-5-6-11-8/h5-7,9H,1-4H2 |
| InChIKey | YNYDCASRUGOZJC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-piperidin-4-yl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-4-yl-1,3-oxazole?
The IUPAC name of 2-piperidin-4-yl-1,3-oxazole (CID 54518272) is 2-piperidin-4-yl-1,3-oxazole.
What is the SMILES notation for 2-piperidin-4-yl-1,3-oxazole?
The canonical SMILES for 2-piperidin-4-yl-1,3-oxazole is c1coc(C2CCNCC2)n1.
What is the InChIKey of 2-piperidin-4-yl-1,3-oxazole?
The InChIKey is YNYDCASRUGOZJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-3-9-4-2-7(1)8-10-5-6-11-8/h5-7,9H,1-4H2.
What are the key properties of 2-piperidin-4-yl-1,3-oxazole?
2-piperidin-4-yl-1,3-oxazole has a molecular weight of 152.20 g/mol, XLogP of 1.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-4-yl-1,3-oxazole is sourced from PubChem (CID 54518272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).