C21H24O4 — CID 54518524
4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-diphenylbutanoic acid (PubChem CID 54518524) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is 4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-diphenylbutanoic acid.
| Compound Name | 4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-diphenylbutanoic acid |
|---|---|
| PubChem CID | 54518524 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-diphenylbutanoic acid |
| SMILES | CC1(C)OC[C@@H](CCC(C(=O)O)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C21H24O4/c1-20(2)24-15-18(25-20)13-14-21(19(22)23,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,18H,13-15H2,1-2H3,(H,22,23)/t18-/m1/s1 |
| InChIKey | YOCJROFWSPBGHT-GOSISDBHSA-N |
| XLogP | 3.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |