C18H17F5N2O7 — CID 54518635
(2,5-dihydroxypyrrol-1-yl) 3,4-dihydroxy-4-methyl-6-[(2,3,4,5,6-pentafluorobenzoyl)amino]hexanoate (PubChem CID 54518635) has the molecular formula C18H17F5N2O7 and a molecular weight of 468.33 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3,4-dihydroxy-4-methyl-6-[(2,3,4,5,6-pentafluorobenzoyl)amino]hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3,4-dihydroxy-4-methyl-6-[(2,3,4,5,6-pentafluorobenzoyl)amino]hexanoate |
|---|---|
| PubChem CID | 54518635 |
| Molecular Formula | C18H17F5N2O7 |
| Molecular Weight | 468.33 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3,4-dihydroxy-4-methyl-6-[(2,3,4,5,6-pentafluorobenzoyl)amino]hexanoate |
| SMILES | CC(O)(CCNC(=O)c1c(F)c(F)c(F)c(F)c1F)C(O)CC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C18H17F5N2O7/c1-18(31,7(26)6-10(29)32-25-8(27)2-3-9(25)28)4-5-24-17(30)11-12(19)14(21)16(23)15(22)13(11)20/h2-3,7,26-28,31H,4-6H2,1H3,(H,24,30) |
| InChIKey | YOEGEOHNWGXNNT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 141.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|