About 4-butylidene-6,7-dihydro-5H-1-benzofuran
4-butylidene-6,7-dihydro-5H-1-benzofuran (PubChem CID 54518756) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 4-butylidene-6,7-dihydro-5H-1-benzofuran.
Molecular Properties
| Compound Name | 4-butylidene-6,7-dihydro-5H-1-benzofuran |
| PubChem CID | 54518756 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 4-butylidene-6,7-dihydro-5H-1-benzofuran |
| SMILES | CCCC=C1CCCc2occc21 |
| InChI | InChI=1S/C12H16O/c1-2-3-5-10-6-4-7-12-11(10)8-9-13-12/h5,8-9H,2-4,6-7H2,1H3 |
| InChIKey | YOGQXTZYGRSLTN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-butylidene-6,7-dihydro-5H-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butylidene-6,7-dihydro-5H-1-benzofuran?
The IUPAC name of 4-butylidene-6,7-dihydro-5H-1-benzofuran (CID 54518756) is 4-butylidene-6,7-dihydro-5H-1-benzofuran.
What is the SMILES notation for 4-butylidene-6,7-dihydro-5H-1-benzofuran?
The canonical SMILES for 4-butylidene-6,7-dihydro-5H-1-benzofuran is CCCC=C1CCCc2occc21.
What is the InChIKey of 4-butylidene-6,7-dihydro-5H-1-benzofuran?
The InChIKey is YOGQXTZYGRSLTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c1-2-3-5-10-6-4-7-12-11(10)8-9-13-12/h5,8-9H,2-4,6-7H2,1H3.
What are the key properties of 4-butylidene-6,7-dihydro-5H-1-benzofuran?
4-butylidene-6,7-dihydro-5H-1-benzofuran has a molecular weight of 176.26 g/mol, XLogP of 3.80, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butylidene-6,7-dihydro-5H-1-benzofuran is sourced from PubChem (CID 54518756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).