C12H14 — CID 54518791
7,8,9,10-tetrahydrobenzo[8]annulene (PubChem CID 54518791) has the molecular formula C12H14 and a molecular weight of 158.24 g/mol. Its IUPAC name is 7,8,9,10-tetrahydrobenzo[8]annulene.
| Compound Name | 7,8,9,10-tetrahydrobenzo[8]annulene |
|---|---|
| PubChem CID | 54518791 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 7,8,9,10-tetrahydrobenzo[8]annulene |
| SMILES | C1=Cc2ccccc2CCCC1 |
| InChI | InChI=1S/C12H14/c1-2-4-8-12-10-6-5-9-11(12)7-3-1/h3,5-7,9-10H,1-2,4,8H2 |
| InChIKey | YSNVMXOXCZUFTA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |