About N-chloro-N,N'-dimethylethanimidamide
N-chloro-N,N'-dimethylethanimidamide (PubChem CID 54519652) has the molecular formula C4H9ClN2
and a molecular weight of 120.58 g/mol. Its IUPAC name is N-chloro-N,N'-dimethylethanimidamide.
Molecular Properties
| Compound Name | N-chloro-N,N'-dimethylethanimidamide |
| PubChem CID | 54519652 |
| Molecular Formula | C4H9ClN2 |
| Molecular Weight | 120.58 g/mol |
| Exact Mass | 120.05 |
| IUPAC Name | N-chloro-N,N'-dimethylethanimidamide |
| SMILES | C/N=C(\C)N(C)Cl |
| InChI | InChI=1S/C4H9ClN2/c1-4(6-2)7(3)5/h1-3H3/b6-4+ |
| InChIKey | YOWKFOWDALBNCM-GQCTYLIASA-N |
| XLogP | 1.12 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.58 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-chloro-N,N'-dimethylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-chloro-N,N'-dimethylethanimidamide?
The IUPAC name of N-chloro-N,N'-dimethylethanimidamide (CID 54519652) is N-chloro-N,N'-dimethylethanimidamide.
What is the SMILES notation for N-chloro-N,N'-dimethylethanimidamide?
The canonical SMILES for N-chloro-N,N'-dimethylethanimidamide is C/N=C(\C)N(C)Cl.
What is the InChIKey of N-chloro-N,N'-dimethylethanimidamide?
The InChIKey is YOWKFOWDALBNCM-GQCTYLIASA-N. The full InChI is InChI=1S/C4H9ClN2/c1-4(6-2)7(3)5/h1-3H3/b6-4+.
What are the key properties of N-chloro-N,N'-dimethylethanimidamide?
N-chloro-N,N'-dimethylethanimidamide has a molecular weight of 120.58 g/mol, XLogP of 1.12, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-chloro-N,N'-dimethylethanimidamide is sourced from PubChem (CID 54519652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).