C14H22S — CID 54519666
(5S,8R,9S)-1,2,8,9-tetramethyl-7-methylidenespiro[4.4]nonane-4-thione (PubChem CID 54519666) has the molecular formula C14H22S and a molecular weight of 222.40 g/mol. Its IUPAC name is (5S,8R,9S)-1,2,8,9-tetramethyl-7-methylidenespiro[4.4]nonane-4-thione.
| Compound Name | (5S,8R,9S)-1,2,8,9-tetramethyl-7-methylidenespiro[4.4]nonane-4-thione |
|---|---|
| PubChem CID | 54519666 |
| Molecular Formula | C14H22S |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (5S,8R,9S)-1,2,8,9-tetramethyl-7-methylidenespiro[4.4]nonane-4-thione |
| SMILES | C=C1C[C@@]2(C(=S)CC(C)C2C)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C14H22S/c1-8-6-13(15)14(11(8)4)7-9(2)10(3)12(14)5/h8,10-12H,2,6-7H2,1,3-5H3/t8?,10-,11?,12-,14-/m0/s1 |
| InChIKey | YOWOVPYGTSSFJW-VXGCKCKHSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|