C24H39N — CID 54519738
N,N-bis(octa-2,7-dienyl)octa-2,7-dien-1-amine (PubChem CID 54519738) has the molecular formula C24H39N and a molecular weight of 341.58 g/mol. Its IUPAC name is N,N-bis(octa-2,7-dienyl)octa-2,7-dien-1-amine.
| Compound Name | N,N-bis(octa-2,7-dienyl)octa-2,7-dien-1-amine |
|---|---|
| PubChem CID | 54519738 |
| Molecular Formula | C24H39N |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 341.31 |
| IUPAC Name | N,N-bis(octa-2,7-dienyl)octa-2,7-dien-1-amine |
| SMILES | C=CCCCC=CCN(CC=CCCCC=C)CC=CCCCC=C |
| InChI | InChI=1S/C24H39N/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h4-6,16-21H,1-3,7-15,22-24H2 |
| InChIKey | YOXWVRXFGYIPIB-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|