C7H11NO3 — CID 54520268
3-(1-hydroxyethyl)-3-methylpyrrolidine-2,5-dione (PubChem CID 54520268) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is 3-(1-hydroxyethyl)-3-methylpyrrolidine-2,5-dione.
| Compound Name | 3-(1-hydroxyethyl)-3-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 54520268 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 3-(1-hydroxyethyl)-3-methylpyrrolidine-2,5-dione |
| SMILES | CC(O)C1(C)CC(=O)NC1=O |
| InChI | InChI=1S/C7H11NO3/c1-4(9)7(2)3-5(10)8-6(7)11/h4,9H,3H2,1-2H3,(H,8,10,11) |
| InChIKey | YPHULFCUFXXVGD-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|