C14H18N2O — CID 54520436
(3R,8R)-13-amino-5-azatricyclo[9.4.0.03,8]pentadeca-1(11),12,14-trien-10-one (PubChem CID 54520436) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is (3R,8R)-13-amino-5-azatricyclo[9.4.0.03,8]pentadeca-1(11),12,14-trien-10-one.
| Compound Name | (3R,8R)-13-amino-5-azatricyclo[9.4.0.03,8]pentadeca-1(11),12,14-trien-10-one |
|---|---|
| PubChem CID | 54520436 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | (3R,8R)-13-amino-5-azatricyclo[9.4.0.03,8]pentadeca-1(11),12,14-trien-10-one |
| SMILES | Nc1ccc2c(c1)C(=O)C[C@H]1CCNC[C@@H]1C2 |
| InChI | InChI=1S/C14H18N2O/c15-12-2-1-10-5-11-8-16-4-3-9(11)6-14(17)13(10)7-12/h1-2,7,9,11,16H,3-6,8,15H2/t9-,11+/m1/s1 |
| InChIKey | YPKVJIYOEYTIIX-KOLCDFICSA-N |
| XLogP | 1.62 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|