C14H16FNO — CID 54520560
(4aR,10bS)-8-fluoro-4-methyl-1,2,4a,5,6,10b-hexahydrobenzo[f]quinolin-3-one (PubChem CID 54520560) has the molecular formula C14H16FNO and a molecular weight of 233.29 g/mol. Its IUPAC name is (4aR,10bS)-8-fluoro-4-methyl-1,2,4a,5,6,10b-hexahydrobenzo[f]quinolin-3-one.
| Compound Name | (4aR,10bS)-8-fluoro-4-methyl-1,2,4a,5,6,10b-hexahydrobenzo[f]quinolin-3-one |
|---|---|
| PubChem CID | 54520560 |
| Molecular Formula | C14H16FNO |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (4aR,10bS)-8-fluoro-4-methyl-1,2,4a,5,6,10b-hexahydrobenzo[f]quinolin-3-one |
| SMILES | CN1C(=O)CC[C@H]2c3ccc(F)cc3CC[C@H]21 |
| InChI | InChI=1S/C14H16FNO/c1-16-13-6-2-9-8-10(15)3-4-11(9)12(13)5-7-14(16)17/h3-4,8,12-13H,2,5-7H2,1H3/t12-,13+/m0/s1 |
| InChIKey | YPMSVDVECSNPIS-QWHCGFSZSA-N |
| XLogP | 2.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |