About N-[difluoro-(2,3,4-trifluorophenyl)methyl]hydroxylamine
N-[difluoro-(2,3,4-trifluorophenyl)methyl]hydroxylamine (PubChem CID 54520746) has the molecular formula C7H4F5NO
and a molecular weight of 213.10 g/mol. Its IUPAC name is N-[difluoro-(2,3,4-trifluorophenyl)methyl]hydroxylamine.
Molecular Properties
| Compound Name | N-[difluoro-(2,3,4-trifluorophenyl)methyl]hydroxylamine |
| PubChem CID | 54520746 |
| Molecular Formula | C7H4F5NO |
| Molecular Weight | 213.10 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | N-[difluoro-(2,3,4-trifluorophenyl)methyl]hydroxylamine |
| SMILES | ONC(F)(F)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C7H4F5NO/c8-4-2-1-3(5(9)6(4)10)7(11,12)13-14/h1-2,13-14H |
| InChIKey | YPPRWJYITIDHRB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.10 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[difluoro-(2,3,4-trifluorophenyl)methyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[difluoro-(2,3,4-trifluorophenyl)methyl]hydroxylamine?
The IUPAC name of N-[difluoro-(2,3,4-trifluorophenyl)methyl]hydroxylamine (CID 54520746) is N-[difluoro-(2,3,4-trifluorophenyl)methyl]hydroxylamine.
What is the SMILES notation for N-[difluoro-(2,3,4-trifluorophenyl)methyl]hydroxylamine?
The canonical SMILES for N-[difluoro-(2,3,4-trifluorophenyl)methyl]hydroxylamine is ONC(F)(F)c1ccc(F)c(F)c1F.
What is the InChIKey of N-[difluoro-(2,3,4-trifluorophenyl)methyl]hydroxylamine?
The InChIKey is YPPRWJYITIDHRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F5NO/c8-4-2-1-3(5(9)6(4)10)7(11,12)13-14/h1-2,13-14H.
What are the key properties of N-[difluoro-(2,3,4-trifluorophenyl)methyl]hydroxylamine?
N-[difluoro-(2,3,4-trifluorophenyl)methyl]hydroxylamine has a molecular weight of 213.10 g/mol, XLogP of 2.13, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[difluoro-(2,3,4-trifluorophenyl)methyl]hydroxylamine is sourced from PubChem (CID 54520746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).