C13H15N3O6S — CID 54520801
2-[[5-(2-ethoxyethyl)-4-(3-methoxy-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]amino]-2-oxoacetic acid (PubChem CID 54520801) has the molecular formula C13H15N3O6S and a molecular weight of 341.35 g/mol. Its IUPAC name is 2-[[5-(2-ethoxyethyl)-4-(3-methoxy-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]amino]-2-oxoacetic acid.
| Compound Name | 2-[[5-(2-ethoxyethyl)-4-(3-methoxy-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 54520801 |
| Molecular Formula | C13H15N3O6S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 2-[[5-(2-ethoxyethyl)-4-(3-methoxy-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]amino]-2-oxoacetic acid |
| SMILES | CCOCCc1sc(NC(=O)C(=O)O)nc1-c1cc(OC)no1 |
| InChI | InChI=1S/C13H15N3O6S/c1-3-21-5-4-8-10(7-6-9(20-2)16-22-7)14-13(23-8)15-11(17)12(18)19/h6H,3-5H2,1-2H3,(H,18,19)(H,14,15,17) |
| InChIKey | YPQVLFZGNIHXCK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 123.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|