C24H32F3NO4 — CID 54521563
dibutyl 2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate (PubChem CID 54521563) has the molecular formula C24H32F3NO4 and a molecular weight of 455.52 g/mol. Its IUPAC name is dibutyl 2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate.
| Compound Name | dibutyl 2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54521563 |
| Molecular Formula | C24H32F3NO4 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | dibutyl 2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate |
| SMILES | CCCCOC(=O)C1C(C)=NC(C)C(C(=O)OCCCC)C1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C24H32F3NO4/c1-5-7-13-31-22(29)19-15(3)28-16(4)20(23(30)32-14-8-6-2)21(19)17-11-9-10-12-18(17)24(25,26)27/h9-12,15,19-21H,5-8,13-14H2,1-4H3 |
| InChIKey | YQESXDGZQCQQSY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|