About 2-[hydroxy(phenyl)methyl]-4,5-dihydroisoindole-1,3-diol
2-[hydroxy(phenyl)methyl]-4,5-dihydroisoindole-1,3-diol (PubChem CID 54521742) has the molecular formula C15H15NO3
and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-[hydroxy(phenyl)methyl]-4,5-dihydroisoindole-1,3-diol.
Molecular Properties
| Compound Name | 2-[hydroxy(phenyl)methyl]-4,5-dihydroisoindole-1,3-diol |
| PubChem CID | 54521742 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2-[hydroxy(phenyl)methyl]-4,5-dihydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1C(O)c1ccccc1)CCC=C2 |
| InChI | InChI=1S/C15H15NO3/c17-13(10-6-2-1-3-7-10)16-14(18)11-8-4-5-9-12(11)15(16)19/h1-4,6-8,13,17-19H,5,9H2 |
| InChIKey | YQHJCXYZVRIIHG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[hydroxy(phenyl)methyl]-4,5-dihydroisoindole-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[hydroxy(phenyl)methyl]-4,5-dihydroisoindole-1,3-diol?
The IUPAC name of 2-[hydroxy(phenyl)methyl]-4,5-dihydroisoindole-1,3-diol (CID 54521742) is 2-[hydroxy(phenyl)methyl]-4,5-dihydroisoindole-1,3-diol.
What is the SMILES notation for 2-[hydroxy(phenyl)methyl]-4,5-dihydroisoindole-1,3-diol?
The canonical SMILES for 2-[hydroxy(phenyl)methyl]-4,5-dihydroisoindole-1,3-diol is Oc1c2c(c(O)n1C(O)c1ccccc1)CCC=C2.
What is the InChIKey of 2-[hydroxy(phenyl)methyl]-4,5-dihydroisoindole-1,3-diol?
The InChIKey is YQHJCXYZVRIIHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO3/c17-13(10-6-2-1-3-7-10)16-14(18)11-8-4-5-9-12(11)15(16)19/h1-4,6-8,13,17-19H,5,9H2.
What are the key properties of 2-[hydroxy(phenyl)methyl]-4,5-dihydroisoindole-1,3-diol?
2-[hydroxy(phenyl)methyl]-4,5-dihydroisoindole-1,3-diol has a molecular weight of 257.29 g/mol, XLogP of 2.40, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[hydroxy(phenyl)methyl]-4,5-dihydroisoindole-1,3-diol is sourced from PubChem (CID 54521742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).