C16H26O7 — CID 54521802
(1R,4R,5R)-1,7,7-trimethyl-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybicyclo[2.2.1]heptan-2-one (PubChem CID 54521802) has the molecular formula C16H26O7 and a molecular weight of 330.38 g/mol. Its IUPAC name is (1R,4R,5R)-1,7,7-trimethyl-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybicyclo[2.2.1]heptan-2-one.
| Compound Name | (1R,4R,5R)-1,7,7-trimethyl-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 54521802 |
| Molecular Formula | C16H26O7 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (1R,4R,5R)-1,7,7-trimethyl-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)[C@H]2CC(=O)[C@]1(C)C[C@H]2O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H26O7/c1-15(2)7-4-10(18)16(15,3)5-8(7)22-14-13(21)12(20)11(19)9(6-17)23-14/h7-9,11-14,17,19-21H,4-6H2,1-3H3/t7-,8+,9+,11+,12-,13+,14+,16-/m0/s1 |
| InChIKey | YQIHQJXXKNXTBN-OWJZKWCUSA-N |
| XLogP | -0.80 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |