About (3-fluoro-4,4,4-trimethoxybut-2-enyl)sulfonylbenzene
(3-fluoro-4,4,4-trimethoxybut-2-enyl)sulfonylbenzene (PubChem CID 54522101) has the molecular formula C13H17FO5S
and a molecular weight of 304.34 g/mol. Its IUPAC name is (3-fluoro-4,4,4-trimethoxybut-2-enyl)sulfonylbenzene.
Molecular Properties
| Compound Name | (3-fluoro-4,4,4-trimethoxybut-2-enyl)sulfonylbenzene |
| PubChem CID | 54522101 |
| Molecular Formula | C13H17FO5S |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | (3-fluoro-4,4,4-trimethoxybut-2-enyl)sulfonylbenzene |
| SMILES | COC(OC)(OC)C(F)=CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H17FO5S/c1-17-13(18-2,19-3)12(14)9-10-20(15,16)11-7-5-4-6-8-11/h4-9H,10H2,1-3H3 |
| InChIKey | YQNNBYLXVSREPX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (3-fluoro-4,4,4-trimethoxybut-2-enyl)sulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluoro-4,4,4-trimethoxybut-2-enyl)sulfonylbenzene?
The IUPAC name of (3-fluoro-4,4,4-trimethoxybut-2-enyl)sulfonylbenzene (CID 54522101) is (3-fluoro-4,4,4-trimethoxybut-2-enyl)sulfonylbenzene.
What is the SMILES notation for (3-fluoro-4,4,4-trimethoxybut-2-enyl)sulfonylbenzene?
The canonical SMILES for (3-fluoro-4,4,4-trimethoxybut-2-enyl)sulfonylbenzene is COC(OC)(OC)C(F)=CCS(=O)(=O)c1ccccc1.
What is the InChIKey of (3-fluoro-4,4,4-trimethoxybut-2-enyl)sulfonylbenzene?
The InChIKey is YQNNBYLXVSREPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17FO5S/c1-17-13(18-2,19-3)12(14)9-10-20(15,16)11-7-5-4-6-8-11/h4-9H,10H2,1-3H3.
What are the key properties of (3-fluoro-4,4,4-trimethoxybut-2-enyl)sulfonylbenzene?
(3-fluoro-4,4,4-trimethoxybut-2-enyl)sulfonylbenzene has a molecular weight of 304.34 g/mol, XLogP of 1.91, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluoro-4,4,4-trimethoxybut-2-enyl)sulfonylbenzene is sourced from PubChem (CID 54522101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).