About 4-ethyl-2,3-dioxo-N-(1-sulfanylidenebutan-2-yl)piperazine-1-carboxamide
4-ethyl-2,3-dioxo-N-(1-sulfanylidenebutan-2-yl)piperazine-1-carboxamide (PubChem CID 54522125) has the molecular formula C11H17N3O3S
and a molecular weight of 271.34 g/mol. Its IUPAC name is 4-ethyl-2,3-dioxo-N-(1-sulfanylidenebutan-2-yl)piperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-ethyl-2,3-dioxo-N-(1-sulfanylidenebutan-2-yl)piperazine-1-carboxamide |
| PubChem CID | 54522125 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 4-ethyl-2,3-dioxo-N-(1-sulfanylidenebutan-2-yl)piperazine-1-carboxamide |
| SMILES | CCC(C=S)NC(=O)N1CCN(CC)C(=O)C1=O |
| InChI | InChI=1S/C11H17N3O3S/c1-3-8(7-18)12-11(17)14-6-5-13(4-2)9(15)10(14)16/h7-8H,3-6H2,1-2H3,(H,12,17) |
| InChIKey | OVEYFGCBZUKIDM-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-2,3-dioxo-N-(1-sulfanylidenebutan-2-yl)piperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2,3-dioxo-N-(1-sulfanylidenebutan-2-yl)piperazine-1-carboxamide?
The IUPAC name of 4-ethyl-2,3-dioxo-N-(1-sulfanylidenebutan-2-yl)piperazine-1-carboxamide (CID 54522125) is 4-ethyl-2,3-dioxo-N-(1-sulfanylidenebutan-2-yl)piperazine-1-carboxamide.
What is the SMILES notation for 4-ethyl-2,3-dioxo-N-(1-sulfanylidenebutan-2-yl)piperazine-1-carboxamide?
The canonical SMILES for 4-ethyl-2,3-dioxo-N-(1-sulfanylidenebutan-2-yl)piperazine-1-carboxamide is CCC(C=S)NC(=O)N1CCN(CC)C(=O)C1=O.
What is the InChIKey of 4-ethyl-2,3-dioxo-N-(1-sulfanylidenebutan-2-yl)piperazine-1-carboxamide?
The InChIKey is OVEYFGCBZUKIDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O3S/c1-3-8(7-18)12-11(17)14-6-5-13(4-2)9(15)10(14)16/h7-8H,3-6H2,1-2H3,(H,12,17).
What are the key properties of 4-ethyl-2,3-dioxo-N-(1-sulfanylidenebutan-2-yl)piperazine-1-carboxamide?
4-ethyl-2,3-dioxo-N-(1-sulfanylidenebutan-2-yl)piperazine-1-carboxamide has a molecular weight of 271.34 g/mol, XLogP of 0.17, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,3-dioxo-N-(1-sulfanylidenebutan-2-yl)piperazine-1-carboxamide is sourced from PubChem (CID 54522125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).