C8H13O6P — CID 54522268
ethyl 3-[(4-methyl-2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]prop-2-enoate (PubChem CID 54522268) has the molecular formula C8H13O6P and a molecular weight of 236.16 g/mol. Its IUPAC name is ethyl 3-[(4-methyl-2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]prop-2-enoate.
| Compound Name | ethyl 3-[(4-methyl-2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]prop-2-enoate |
|---|---|
| PubChem CID | 54522268 |
| Molecular Formula | C8H13O6P |
| Molecular Weight | 236.16 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | ethyl 3-[(4-methyl-2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]prop-2-enoate |
| SMILES | CCOC(=O)C=COP1(=O)OCC(C)O1 |
| InChI | InChI=1S/C8H13O6P/c1-3-11-8(9)4-5-12-15(10)13-6-7(2)14-15/h4-5,7H,3,6H2,1-2H3 |
| InChIKey | YQQIHRUISMFGGI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.16 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|