About (3R,5S)-3,5-bis(ethenyl)cyclopentene
(3R,5S)-3,5-bis(ethenyl)cyclopentene (PubChem CID 54522339) has the molecular formula C9H12
and a molecular weight of 120.19 g/mol. Its IUPAC name is (3R,5S)-3,5-bis(ethenyl)cyclopentene.
Molecular Properties
| Compound Name | (3R,5S)-3,5-bis(ethenyl)cyclopentene |
|---|
| PubChem CID | 54522339 |
|---|
| Molecular Formula | C9H12 |
|---|
| Molecular Weight | 120.19 g/mol |
|---|
| Exact Mass | 120.09 |
|---|
| IUPAC Name | (3R,5S)-3,5-bis(ethenyl)cyclopentene |
|---|
| SMILES | C=C[C@@H]1C=C[C@H](C=C)C1 |
|---|
| InChI | InChI=1S/C9H12/c1-3-8-5-6-9(4-2)7-8/h3-6,8-9H,1-2,7H2/t8-,9+ |
|---|
| InChIKey | YQRRIJJICAASBG-DTORHVGOSA-N |
|---|
| XLogP | 2.55 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | 2 |
|---|
| Heavy Atoms | 9 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R,5S)-3,5-bis(ethenyl)cyclopentene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5S)-3,5-bis(ethenyl)cyclopentene?
The IUPAC name of (3R,5S)-3,5-bis(ethenyl)cyclopentene (CID 54522339) is (3R,5S)-3,5-bis(ethenyl)cyclopentene.
What is the SMILES notation for (3R,5S)-3,5-bis(ethenyl)cyclopentene?
The canonical SMILES for (3R,5S)-3,5-bis(ethenyl)cyclopentene is C=C[C@@H]1C=C[C@H](C=C)C1.
What is the InChIKey of (3R,5S)-3,5-bis(ethenyl)cyclopentene?
The InChIKey is YQRRIJJICAASBG-DTORHVGOSA-N. The full InChI is InChI=1S/C9H12/c1-3-8-5-6-9(4-2)7-8/h3-6,8-9H,1-2,7H2/t8-,9+.
What are the key properties of (3R,5S)-3,5-bis(ethenyl)cyclopentene?
(3R,5S)-3,5-bis(ethenyl)cyclopentene has a molecular weight of 120.19 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5S)-3,5-bis(ethenyl)cyclopentene is sourced from PubChem (CID 54522339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).