C28H28F3NO5 — CID 54522464
1-[2-[dimethoxy(trityloxy)methyl]-4-hydroxypyrrolidin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 54522464) has the molecular formula C28H28F3NO5 and a molecular weight of 515.53 g/mol. Its IUPAC name is 1-[2-[dimethoxy(trityloxy)methyl]-4-hydroxypyrrolidin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[2-[dimethoxy(trityloxy)methyl]-4-hydroxypyrrolidin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 54522464 |
| Molecular Formula | C28H28F3NO5 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | 1-[2-[dimethoxy(trityloxy)methyl]-4-hydroxypyrrolidin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | COC(OC)(OC(c1ccccc1)(c1ccccc1)c1ccccc1)C1CC(O)CN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C28H28F3NO5/c1-35-28(36-2,24-18-23(33)19-32(24)25(34)27(29,30)31)37-26(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17,23-24,33H,18-19H2,1-2H3 |
| InChIKey | YQUAJLMHRUIMSL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|