About 6-O-ethyl 1-O-methyl 5-oxo-2-phenylsulfanylhex-2-enedioate
6-O-ethyl 1-O-methyl 5-oxo-2-phenylsulfanylhex-2-enedioate (PubChem CID 54522573) has the molecular formula C15H16O5S
and a molecular weight of 308.36 g/mol. Its IUPAC name is 6-O-ethyl 1-O-methyl 5-oxo-2-phenylsulfanylhex-2-enedioate.
Molecular Properties
| Compound Name | 6-O-ethyl 1-O-methyl 5-oxo-2-phenylsulfanylhex-2-enedioate |
| PubChem CID | 54522573 |
| Molecular Formula | C15H16O5S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 6-O-ethyl 1-O-methyl 5-oxo-2-phenylsulfanylhex-2-enedioate |
| SMILES | CCOC(=O)C(=O)CC=C(Sc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C15H16O5S/c1-3-20-14(17)12(16)9-10-13(15(18)19-2)21-11-7-5-4-6-8-11/h4-8,10H,3,9H2,1-2H3 |
| InChIKey | YQWITVVBNSVMHY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-O-ethyl 1-O-methyl 5-oxo-2-phenylsulfanylhex-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-O-ethyl 1-O-methyl 5-oxo-2-phenylsulfanylhex-2-enedioate?
The IUPAC name of 6-O-ethyl 1-O-methyl 5-oxo-2-phenylsulfanylhex-2-enedioate (CID 54522573) is 6-O-ethyl 1-O-methyl 5-oxo-2-phenylsulfanylhex-2-enedioate.
What is the SMILES notation for 6-O-ethyl 1-O-methyl 5-oxo-2-phenylsulfanylhex-2-enedioate?
The canonical SMILES for 6-O-ethyl 1-O-methyl 5-oxo-2-phenylsulfanylhex-2-enedioate is CCOC(=O)C(=O)CC=C(Sc1ccccc1)C(=O)OC.
What is the InChIKey of 6-O-ethyl 1-O-methyl 5-oxo-2-phenylsulfanylhex-2-enedioate?
The InChIKey is YQWITVVBNSVMHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O5S/c1-3-20-14(17)12(16)9-10-13(15(18)19-2)21-11-7-5-4-6-8-11/h4-8,10H,3,9H2,1-2H3.
What are the key properties of 6-O-ethyl 1-O-methyl 5-oxo-2-phenylsulfanylhex-2-enedioate?
6-O-ethyl 1-O-methyl 5-oxo-2-phenylsulfanylhex-2-enedioate has a molecular weight of 308.36 g/mol, XLogP of 2.36, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-O-ethyl 1-O-methyl 5-oxo-2-phenylsulfanylhex-2-enedioate is sourced from PubChem (CID 54522573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).