About 1,1-dibromo-3,4-dichlorobutane
1,1-dibromo-3,4-dichlorobutane (PubChem CID 54522794) has the molecular formula C4H6Br2Cl2
and a molecular weight of 284.81 g/mol. Its IUPAC name is 1,1-dibromo-3,4-dichlorobutane.
Molecular Properties
| Compound Name | 1,1-dibromo-3,4-dichlorobutane |
| PubChem CID | 54522794 |
| Molecular Formula | C4H6Br2Cl2 |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 281.82 |
| IUPAC Name | 1,1-dibromo-3,4-dichlorobutane |
| SMILES | ClCC(Cl)CC(Br)Br |
| InChI | InChI=1S/C4H6Br2Cl2/c5-4(6)1-3(8)2-7/h3-4H,1-2H2 |
| InChIKey | VBWKXYKGWRMOSF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dibromo-3,4-dichlorobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dibromo-3,4-dichlorobutane?
The IUPAC name of 1,1-dibromo-3,4-dichlorobutane (CID 54522794) is 1,1-dibromo-3,4-dichlorobutane.
What is the SMILES notation for 1,1-dibromo-3,4-dichlorobutane?
The canonical SMILES for 1,1-dibromo-3,4-dichlorobutane is ClCC(Cl)CC(Br)Br.
What is the InChIKey of 1,1-dibromo-3,4-dichlorobutane?
The InChIKey is VBWKXYKGWRMOSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6Br2Cl2/c5-4(6)1-3(8)2-7/h3-4H,1-2H2.
What are the key properties of 1,1-dibromo-3,4-dichlorobutane?
1,1-dibromo-3,4-dichlorobutane has a molecular weight of 284.81 g/mol, XLogP of 3.34, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dibromo-3,4-dichlorobutane is sourced from PubChem (CID 54522794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).