About 2-pyridazin-3-yloxypropane-1,3-diol
2-pyridazin-3-yloxypropane-1,3-diol (PubChem CID 54522855) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is 2-pyridazin-3-yloxypropane-1,3-diol.
Molecular Properties
| Compound Name | 2-pyridazin-3-yloxypropane-1,3-diol |
| PubChem CID | 54522855 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 2-pyridazin-3-yloxypropane-1,3-diol |
| SMILES | OCC(CO)Oc1cccnn1 |
| InChI | InChI=1S/C7H10N2O3/c10-4-6(5-11)12-7-2-1-3-8-9-7/h1-3,6,10-11H,4-5H2 |
| InChIKey | XSFGXUGZDVZODH-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-pyridazin-3-yloxypropane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridazin-3-yloxypropane-1,3-diol?
The IUPAC name of 2-pyridazin-3-yloxypropane-1,3-diol (CID 54522855) is 2-pyridazin-3-yloxypropane-1,3-diol.
What is the SMILES notation for 2-pyridazin-3-yloxypropane-1,3-diol?
The canonical SMILES for 2-pyridazin-3-yloxypropane-1,3-diol is OCC(CO)Oc1cccnn1.
What is the InChIKey of 2-pyridazin-3-yloxypropane-1,3-diol?
The InChIKey is XSFGXUGZDVZODH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c10-4-6(5-11)12-7-2-1-3-8-9-7/h1-3,6,10-11H,4-5H2.
What are the key properties of 2-pyridazin-3-yloxypropane-1,3-diol?
2-pyridazin-3-yloxypropane-1,3-diol has a molecular weight of 170.17 g/mol, XLogP of -0.79, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridazin-3-yloxypropane-1,3-diol is sourced from PubChem (CID 54522855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).