C37H42O6S2 — CID 54523007
(3R,4S,5R,6R)-2-[bis(methylsulfanyl)methyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol (PubChem CID 54523007) has the molecular formula C37H42O6S2 and a molecular weight of 646.87 g/mol. Its IUPAC name is (3R,4S,5R,6R)-2-[bis(methylsulfanyl)methyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol.
| Compound Name | (3R,4S,5R,6R)-2-[bis(methylsulfanyl)methyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 54523007 |
| Molecular Formula | C37H42O6S2 |
| Molecular Weight | 646.87 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | (3R,4S,5R,6R)-2-[bis(methylsulfanyl)methyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
| SMILES | CSC(SC)C1(O)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C37H42O6S2/c1-44-36(45-2)37(38)35(42-26-31-21-13-6-14-22-31)34(41-25-30-19-11-5-12-20-30)33(40-24-29-17-9-4-10-18-29)32(43-37)27-39-23-28-15-7-3-8-16-28/h3-22,32-36,38H,23-27H2,1-2H3/t32-,33-,34+,35-,37?/m1/s1 |
| InChIKey | YREBIGRUSFZWRX-MVQSBWCGSA-N |
| XLogP | 7.10 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.87 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|