C9H12O6 — CID 54523249
5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-hydroxyoxolane-2,3-dione (PubChem CID 54523249) has the molecular formula C9H12O6 and a molecular weight of 216.19 g/mol. Its IUPAC name is 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-hydroxyoxolane-2,3-dione.
| Compound Name | 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-hydroxyoxolane-2,3-dione |
|---|---|
| PubChem CID | 54523249 |
| Molecular Formula | C9H12O6 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-hydroxyoxolane-2,3-dione |
| SMILES | CC1(C)OCC(C2OC(=O)C(=O)C2O)O1 |
| InChI | InChI=1S/C9H12O6/c1-9(2)13-3-4(15-9)7-5(10)6(11)8(12)14-7/h4-5,7,10H,3H2,1-2H3 |
| InChIKey | YRIJMIJJXQAZJU-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|