C12H9Cl2NO3 — CID 54523275
2-(2,4-dichlorophenyl)-N-(5-oxo-2H-furan-3-yl)acetamide (PubChem CID 54523275) has the molecular formula C12H9Cl2NO3 and a molecular weight of 286.11 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-(5-oxo-2H-furan-3-yl)acetamide.
| Compound Name | 2-(2,4-dichlorophenyl)-N-(5-oxo-2H-furan-3-yl)acetamide |
|---|---|
| PubChem CID | 54523275 |
| Molecular Formula | C12H9Cl2NO3 |
| Molecular Weight | 286.11 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-(5-oxo-2H-furan-3-yl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)NC1=CC(=O)OC1 |
| InChI | InChI=1S/C12H9Cl2NO3/c13-8-2-1-7(10(14)4-8)3-11(16)15-9-5-12(17)18-6-9/h1-2,4-5H,3,6H2,(H,15,16) |
| InChIKey | YRISMALZPUYMMX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.11 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |