About 1-iodoethyl formate
1-iodoethyl formate (PubChem CID 54523341) has the molecular formula C3H5IO2
and a molecular weight of 199.97 g/mol. Its IUPAC name is 1-iodoethyl formate.
Molecular Properties
| Compound Name | 1-iodoethyl formate |
| PubChem CID | 54523341 |
| Molecular Formula | C3H5IO2 |
| Molecular Weight | 199.97 g/mol |
| Exact Mass | 199.93 |
| IUPAC Name | 1-iodoethyl formate |
| SMILES | CC(I)OC=O |
| InChI | InChI=1S/C3H5IO2/c1-3(4)6-2-5/h2-3H,1H3 |
| InChIKey | AAJPWASDTGKGBW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.97 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodoethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodoethyl formate?
The IUPAC name of 1-iodoethyl formate (CID 54523341) is 1-iodoethyl formate.
What is the SMILES notation for 1-iodoethyl formate?
The canonical SMILES for 1-iodoethyl formate is CC(I)OC=O.
What is the InChIKey of 1-iodoethyl formate?
The InChIKey is AAJPWASDTGKGBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5IO2/c1-3(4)6-2-5/h2-3H,1H3.
What are the key properties of 1-iodoethyl formate?
1-iodoethyl formate has a molecular weight of 199.97 g/mol, XLogP of 0.94, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodoethyl formate is sourced from PubChem (CID 54523341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).