C24H38N3O+ — CID 54523511
3-[1-benzyl-3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1,3-diethyl-2,6-dihydropyridin-1-ium-2-yl]propan-1-amine (PubChem CID 54523511) has the molecular formula C24H38N3O+ and a molecular weight of 384.59 g/mol. Its IUPAC name is 3-[1-benzyl-3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1,3-diethyl-2,6-dihydropyridin-1-ium-2-yl]propan-1-amine.
| Compound Name | 3-[1-benzyl-3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1,3-diethyl-2,6-dihydropyridin-1-ium-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 54523511 |
| Molecular Formula | C24H38N3O+ |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | 3-[1-benzyl-3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1,3-diethyl-2,6-dihydropyridin-1-ium-2-yl]propan-1-amine |
| SMILES | CCC1(C2=NC(C)(C)CO2)C=CC[N+](CC)(Cc2ccccc2)C1CCCN |
| InChI | InChI=1S/C24H38N3O/c1-5-24(22-26-23(3,4)19-28-22)15-11-17-27(6-2,21(24)14-10-16-25)18-20-12-8-7-9-13-20/h7-9,11-13,15,21H,5-6,10,14,16-19,25H2,1-4H3/q+1 |
| InChIKey | SPOJWQUHJPENBI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|