About N-(1,2,5-trihydroxypyrrol-3-yl)acetamide
N-(1,2,5-trihydroxypyrrol-3-yl)acetamide (PubChem CID 54523654) has the molecular formula C6H8N2O4
and a molecular weight of 172.14 g/mol. Its IUPAC name is N-(1,2,5-trihydroxypyrrol-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(1,2,5-trihydroxypyrrol-3-yl)acetamide |
| PubChem CID | 54523654 |
| Molecular Formula | C6H8N2O4 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | N-(1,2,5-trihydroxypyrrol-3-yl)acetamide |
| SMILES | CC(=O)Nc1cc(O)n(O)c1O |
| InChI | InChI=1S/C6H8N2O4/c1-3(9)7-4-2-5(10)8(12)6(4)11/h2,10-12H,1H3,(H,7,9) |
| InChIKey | YRPCUHSOMMHCBM-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-(1,2,5-trihydroxypyrrol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,2,5-trihydroxypyrrol-3-yl)acetamide?
The IUPAC name of N-(1,2,5-trihydroxypyrrol-3-yl)acetamide (CID 54523654) is N-(1,2,5-trihydroxypyrrol-3-yl)acetamide.
What is the SMILES notation for N-(1,2,5-trihydroxypyrrol-3-yl)acetamide?
The canonical SMILES for N-(1,2,5-trihydroxypyrrol-3-yl)acetamide is CC(=O)Nc1cc(O)n(O)c1O.
What is the InChIKey of N-(1,2,5-trihydroxypyrrol-3-yl)acetamide?
The InChIKey is YRPCUHSOMMHCBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O4/c1-3(9)7-4-2-5(10)8(12)6(4)11/h2,10-12H,1H3,(H,7,9).
What are the key properties of N-(1,2,5-trihydroxypyrrol-3-yl)acetamide?
N-(1,2,5-trihydroxypyrrol-3-yl)acetamide has a molecular weight of 172.14 g/mol, XLogP of 0.09, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,2,5-trihydroxypyrrol-3-yl)acetamide is sourced from PubChem (CID 54523654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).