About 2-chloro-1,3-diphenyl-4,5-dihydroimidazol-1-ium
2-chloro-1,3-diphenyl-4,5-dihydroimidazol-1-ium (PubChem CID 54523952) has the molecular formula C15H14ClN2+
and a molecular weight of 257.74 g/mol. Its IUPAC name is 2-chloro-1,3-diphenyl-4,5-dihydroimidazol-1-ium.
Molecular Properties
| Compound Name | 2-chloro-1,3-diphenyl-4,5-dihydroimidazol-1-ium |
| PubChem CID | 54523952 |
| Molecular Formula | C15H14ClN2+ |
| Molecular Weight | 257.74 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-chloro-1,3-diphenyl-4,5-dihydroimidazol-1-ium |
| SMILES | ClC1=[N+](c2ccccc2)CCN1c1ccccc1 |
| InChI | InChI=1S/C15H14ClN2/c16-15-17(13-7-3-1-4-8-13)11-12-18(15)14-9-5-2-6-10-14/h1-10H,11-12H2/q+1 |
| InChIKey | YRUHTZRRNUVQJS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.74 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1,3-diphenyl-4,5-dihydroimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,3-diphenyl-4,5-dihydroimidazol-1-ium?
The IUPAC name of 2-chloro-1,3-diphenyl-4,5-dihydroimidazol-1-ium (CID 54523952) is 2-chloro-1,3-diphenyl-4,5-dihydroimidazol-1-ium.
What is the SMILES notation for 2-chloro-1,3-diphenyl-4,5-dihydroimidazol-1-ium?
The canonical SMILES for 2-chloro-1,3-diphenyl-4,5-dihydroimidazol-1-ium is ClC1=[N+](c2ccccc2)CCN1c1ccccc1.
What is the InChIKey of 2-chloro-1,3-diphenyl-4,5-dihydroimidazol-1-ium?
The InChIKey is YRUHTZRRNUVQJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClN2/c16-15-17(13-7-3-1-4-8-13)11-12-18(15)14-9-5-2-6-10-14/h1-10H,11-12H2/q+1.
What are the key properties of 2-chloro-1,3-diphenyl-4,5-dihydroimidazol-1-ium?
2-chloro-1,3-diphenyl-4,5-dihydroimidazol-1-ium has a molecular weight of 257.74 g/mol, XLogP of 3.45, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,3-diphenyl-4,5-dihydroimidazol-1-ium is sourced from PubChem (CID 54523952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).