About ethyl 2-ethanimidoylhexanoate
ethyl 2-ethanimidoylhexanoate (PubChem CID 54524706) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is ethyl 2-ethanimidoylhexanoate.
Molecular Properties
| Compound Name | ethyl 2-ethanimidoylhexanoate |
| PubChem CID | 54524706 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | ethyl 2-ethanimidoylhexanoate |
| SMILES | [H]/N=C(\C)C(CCCC)C(=O)OCC |
| InChI | InChI=1S/C10H19NO2/c1-4-6-7-9(8(3)11)10(12)13-5-2/h9,11H,4-7H2,1-3H3/b11-8+ |
| InChIKey | YSHZHJKRJCEQBV-DHZHZOJOSA-N |
| XLogP | 2.40 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-ethanimidoylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-ethanimidoylhexanoate?
The IUPAC name of ethyl 2-ethanimidoylhexanoate (CID 54524706) is ethyl 2-ethanimidoylhexanoate.
What is the SMILES notation for ethyl 2-ethanimidoylhexanoate?
The canonical SMILES for ethyl 2-ethanimidoylhexanoate is [H]/N=C(\C)C(CCCC)C(=O)OCC.
What is the InChIKey of ethyl 2-ethanimidoylhexanoate?
The InChIKey is YSHZHJKRJCEQBV-DHZHZOJOSA-N. The full InChI is InChI=1S/C10H19NO2/c1-4-6-7-9(8(3)11)10(12)13-5-2/h9,11H,4-7H2,1-3H3/b11-8+.
What are the key properties of ethyl 2-ethanimidoylhexanoate?
ethyl 2-ethanimidoylhexanoate has a molecular weight of 185.27 g/mol, XLogP of 2.40, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-ethanimidoylhexanoate is sourced from PubChem (CID 54524706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).