2-methoxycarbonyl-3,7a-dihydro-1H-isoindole-3a-carboxylic acid

C11H13NO4 — CID 54525274

IUPAC2-methoxycarbonyl-3,7a-dihydro-1H-isoindole-3a-carboxylic acid
SMILESCOC(=O)N1CC2C=CC=CC2(C(=O)O)C1
InChIInChI=1S/C11H13NO4/c1-16-10(15)12-6-8-4-2-3-5-11(8,7-12)9(13)14/h2-5,8H,6-7H2,1H3,(H,13,14)
InChIKeyYSRMGDPVIVAJAZ-UHFFFAOYSA-N
MW223.23 g/mol
LogP0.88
Rot. Bonds1

About 2-methoxycarbonyl-3,7a-dihydro-1H-isoindole-3a-carboxylic acid

2-methoxycarbonyl-3,7a-dihydro-1H-isoindole-3a-carboxylic acid (PubChem CID 54525274) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is 2-methoxycarbonyl-3,7a-dihydro-1H-isoindole-3a-carboxylic acid.

Molecular Properties

Compound Name2-methoxycarbonyl-3,7a-dihydro-1H-isoindole-3a-carboxylic acid
PubChem CID54525274
Molecular FormulaC11H13NO4
Molecular Weight223.23 g/mol
Exact Mass223.08
IUPAC Name2-methoxycarbonyl-3,7a-dihydro-1H-isoindole-3a-carboxylic acid
SMILESCOC(=O)N1CC2C=CC=CC2(C(=O)O)C1
InChIInChI=1S/C11H13NO4/c1-16-10(15)12-6-8-4-2-3-5-11(8,7-12)9(13)14/h2-5,8H,6-7H2,1H3,(H,13,14)
InChIKeyYSRMGDPVIVAJAZ-UHFFFAOYSA-N
XLogP0.88
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.23
LogP ≤ 50.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-methoxycarbonyl-3,7a-dihydro-1H-isoindole-3a-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methoxycarbonyl-3,7a-dihydro-1H-isoindole-3a-carboxylic acid?
The IUPAC name of 2-methoxycarbonyl-3,7a-dihydro-1H-isoindole-3a-carboxylic acid (CID 54525274) is 2-methoxycarbonyl-3,7a-dihydro-1H-isoindole-3a-carboxylic acid.
What is the SMILES notation for 2-methoxycarbonyl-3,7a-dihydro-1H-isoindole-3a-carboxylic acid?
The canonical SMILES for 2-methoxycarbonyl-3,7a-dihydro-1H-isoindole-3a-carboxylic acid is COC(=O)N1CC2C=CC=CC2(C(=O)O)C1.
What is the InChIKey of 2-methoxycarbonyl-3,7a-dihydro-1H-isoindole-3a-carboxylic acid?
The InChIKey is YSRMGDPVIVAJAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO4/c1-16-10(15)12-6-8-4-2-3-5-11(8,7-12)9(13)14/h2-5,8H,6-7H2,1H3,(H,13,14).
What are the key properties of 2-methoxycarbonyl-3,7a-dihydro-1H-isoindole-3a-carboxylic acid?
2-methoxycarbonyl-3,7a-dihydro-1H-isoindole-3a-carboxylic acid has a molecular weight of 223.23 g/mol, XLogP of 0.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxycarbonyl-3,7a-dihydro-1H-isoindole-3a-carboxylic acid is sourced from PubChem (CID 54525274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).