About tert-butyl 2-[(3-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl)amino]-2-oxoacetate
tert-butyl 2-[(3-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl)amino]-2-oxoacetate (PubChem CID 54525440) has the molecular formula C14H17NO5
and a molecular weight of 279.29 g/mol. Its IUPAC name is tert-butyl 2-[(3-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl)amino]-2-oxoacetate.
Molecular Properties
| Compound Name | tert-butyl 2-[(3-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl)amino]-2-oxoacetate |
| PubChem CID | 54525440 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | tert-butyl 2-[(3-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl)amino]-2-oxoacetate |
| SMILES | COc1cccc(=O)c(NC(=O)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C14H17NO5/c1-14(2,3)20-13(18)12(17)15-10-8-9(19-4)6-5-7-11(10)16/h5-8H,1-4H3,(H,15,16,17) |
| InChIKey | YSUJHJIMZXGQAU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[(3-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl)amino]-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[(3-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl)amino]-2-oxoacetate?
The IUPAC name of tert-butyl 2-[(3-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl)amino]-2-oxoacetate (CID 54525440) is tert-butyl 2-[(3-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl)amino]-2-oxoacetate.
What is the SMILES notation for tert-butyl 2-[(3-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl)amino]-2-oxoacetate?
The canonical SMILES for tert-butyl 2-[(3-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl)amino]-2-oxoacetate is COc1cccc(=O)c(NC(=O)C(=O)OC(C)(C)C)c1.
What is the InChIKey of tert-butyl 2-[(3-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl)amino]-2-oxoacetate?
The InChIKey is YSUJHJIMZXGQAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO5/c1-14(2,3)20-13(18)12(17)15-10-8-9(19-4)6-5-7-11(10)16/h5-8H,1-4H3,(H,15,16,17).
What are the key properties of tert-butyl 2-[(3-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl)amino]-2-oxoacetate?
tert-butyl 2-[(3-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl)amino]-2-oxoacetate has a molecular weight of 279.29 g/mol, XLogP of 1.34, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[(3-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl)amino]-2-oxoacetate is sourced from PubChem (CID 54525440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).